C10H13N5O5 — CID 171899987
3,4-dihydroxy-4-(3-methyl-2,6-dioxo-7H-purin-8-yl)butanamide (PubChem CID 171899987) has the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(3-methyl-2,6-dioxo-7H-purin-8-yl)butanamide.
| Compound Name | 3,4-dihydroxy-4-(3-methyl-2,6-dioxo-7H-purin-8-yl)butanamide |
|---|---|
| PubChem CID | 171899987 |
| Molecular Formula | C10H13N5O5 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 3,4-dihydroxy-4-(3-methyl-2,6-dioxo-7H-purin-8-yl)butanamide |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(C(O)C(O)CC(N)=O)nc21 |
| InChI | InChI=1S/C10H13N5O5/c1-15-8-5(9(19)14-10(15)20)12-7(13-8)6(18)3(16)2-4(11)17/h3,6,16,18H,2H2,1H3,(H2,11,17)(H,12,13)(H,14,19,20) |
| InChIKey | OUELZQZDAFXWMK-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 167.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |