C9H10N4O6 — CID 170824769
2,3-dihydroxy-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanoic acid (PubChem CID 170824769) has the molecular formula C9H10N4O6 and a molecular weight of 270.20 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanoic acid.
| Compound Name | 2,3-dihydroxy-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanoic acid |
|---|---|
| PubChem CID | 170824769 |
| Molecular Formula | C9H10N4O6 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2,3-dihydroxy-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanoic acid |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(C(O)C(O)C(=O)O)nc21 |
| InChI | InChI=1S/C9H10N4O6/c1-13-6-2(7(16)12-9(13)19)10-5(11-6)3(14)4(15)8(17)18/h3-4,14-15H,1H3,(H,10,11)(H,17,18)(H,12,16,19) |
| InChIKey | PDURGXMTDNHRKP-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 161.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |