C12H10N8O4S — CID 3103863
3-methyl-8-[(3-methyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]-7H-purine-2,6-dione (PubChem CID 3103863) has the molecular formula C12H10N8O4S and a molecular weight of 362.33 g/mol. Its IUPAC name is 3-methyl-8-[(3-methyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]-7H-purine-2,6-dione.
| Compound Name | 3-methyl-8-[(3-methyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 3103863 |
| Molecular Formula | C12H10N8O4S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 3-methyl-8-[(3-methyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(Sc3nc4c([nH]3)c(=O)[nH]c(=O)n4C)nc21 |
| InChI | InChI=1S/C12H10N8O4S/c1-19-5-3(7(21)17-11(19)23)13-9(15-5)25-10-14-4-6(16-10)20(2)12(24)18-8(4)22/h1-2H3,(H,13,15)(H,14,16)(H,17,21,23)(H,18,22,24) |
| InChIKey | HNZTVEAZXWEJJG-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 167.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |