C9H8N4O2S — CID 169487336
3-methyl-8-(3-sulfanylprop-1-ynyl)-7H-purine-2,6-dione (PubChem CID 169487336) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 3-methyl-8-(3-sulfanylprop-1-ynyl)-7H-purine-2,6-dione.
| Compound Name | 3-methyl-8-(3-sulfanylprop-1-ynyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 169487336 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-methyl-8-(3-sulfanylprop-1-ynyl)-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(C#CCS)nc21 |
| InChI | InChI=1S/C9H8N4O2S/c1-13-7-6(8(14)12-9(13)15)10-5(11-7)3-2-4-16/h16H,4H2,1H3,(H,10,11)(H,12,14,15) |
| InChIKey | VPZKOXOQSZGNLS-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|