C9H9ClN4O2 — CID 169478060
8-(3-chloroprop-1-enyl)-3-methyl-7H-purine-2,6-dione (PubChem CID 169478060) has the molecular formula C9H9ClN4O2 and a molecular weight of 240.65 g/mol. Its IUPAC name is 8-(3-chloroprop-1-enyl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(3-chloroprop-1-enyl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 169478060 |
| Molecular Formula | C9H9ClN4O2 |
| Molecular Weight | 240.65 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 8-(3-chloroprop-1-enyl)-3-methyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(C=CCCl)nc21 |
| InChI | InChI=1S/C9H9ClN4O2/c1-14-7-6(8(15)13-9(14)16)11-5(12-7)3-2-4-10/h2-3H,4H2,1H3,(H,11,12)(H,13,15,16) |
| InChIKey | QWXOSTNDVZRDMO-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.65 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|