C12H14N4O3S — CID 170480902
S-[4-(3-methyl-2,6-dioxo-7H-purin-8-yl)but-3-enyl] ethanethioate (PubChem CID 170480902) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is S-[4-(3-methyl-2,6-dioxo-7H-purin-8-yl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(3-methyl-2,6-dioxo-7H-purin-8-yl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480902 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | S-[4-(3-methyl-2,6-dioxo-7H-purin-8-yl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1nc2c([nH]1)c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C12H14N4O3S/c1-7(17)20-6-4-3-5-8-13-9-10(14-8)16(2)12(19)15-11(9)18/h3,5H,4,6H2,1-2H3,(H,13,14)(H,15,18,19) |
| InChIKey | UOEXOWBDKMMNFF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|