C17H23BN4O5S — CID 170805396
S-[3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170805396) has the molecular formula C17H23BN4O5S and a molecular weight of 406.27 g/mol. Its IUPAC name is S-[3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170805396 |
| Molecular Formula | C17H23BN4O5S |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | S-[3-(3-methyl-2,6-dioxo-7H-purin-8-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1nc2c([nH]1)c(=O)[nH]c(=O)n2C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H23BN4O5S/c1-9(23)28-8-10(18-26-16(2,3)17(4,5)27-18)7-11-19-12-13(20-11)22(6)15(25)21-14(12)24/h7H,8H2,1-6H3,(H,19,20)(H,21,24,25) |
| InChIKey | BZCFLBNLNFKXJH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 119.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|