C17H22BN3O3S — CID 170804867
S-[3-imidazo[1,2-b]pyridazin-3-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170804867) has the molecular formula C17H22BN3O3S and a molecular weight of 359.26 g/mol. Its IUPAC name is S-[3-imidazo[1,2-b]pyridazin-3-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-imidazo[1,2-b]pyridazin-3-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170804867 |
| Molecular Formula | C17H22BN3O3S |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | S-[3-imidazo[1,2-b]pyridazin-3-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1cnc2cccnn12)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H22BN3O3S/c1-12(22)25-11-13(18-23-16(2,3)17(4,5)24-18)9-14-10-19-15-7-6-8-20-21(14)15/h6-10H,11H2,1-5H3 |
| InChIKey | ZRLKSKDXYBYWSI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|