C15H21BN4O2 — CID 170806496
3-imidazo[1,2-b]pyridazin-3-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170806496) has the molecular formula C15H21BN4O2 and a molecular weight of 300.17 g/mol. Its IUPAC name is 3-imidazo[1,2-b]pyridazin-3-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-imidazo[1,2-b]pyridazin-3-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170806496 |
| Molecular Formula | C15H21BN4O2 |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 3-imidazo[1,2-b]pyridazin-3-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CC1(C)OB(C(=Cc2cnc3cccnn23)CN)OC1(C)C |
| InChI | InChI=1S/C15H21BN4O2/c1-14(2)15(3,4)22-16(21-14)11(9-17)8-12-10-18-13-6-5-7-19-20(12)13/h5-8,10H,9,17H2,1-4H3 |
| InChIKey | SPBIAFHKYAOARZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|