C17H22BClN4O3 — CID 170808187
N-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808187) has the molecular formula C17H22BClN4O3 and a molecular weight of 376.65 g/mol. Its IUPAC name is N-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808187 |
| Molecular Formula | C17H22BClN4O3 |
| Molecular Weight | 376.65 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-[3-(6-chloroimidazo[1,2-b]pyridazin-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1cnc2ccc(Cl)nn12)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H22BClN4O3/c1-11(24)20-9-12(18-25-16(2,3)17(4,5)26-18)8-13-10-21-15-7-6-14(19)22-23(13)15/h6-8,10H,9H2,1-5H3,(H,20,24) |
| InChIKey | QPLSNZBRNDUSDX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|