C17H24BNO5 — CID 170807548
N-[3-(2,6-dihydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170807548) has the molecular formula C17H24BNO5 and a molecular weight of 333.19 g/mol. Its IUPAC name is N-[3-(2,6-dihydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(2,6-dihydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807548 |
| Molecular Formula | C17H24BNO5 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-[3-(2,6-dihydroxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1c(O)cccc1O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H24BNO5/c1-11(20)19-10-12(9-13-14(21)7-6-8-15(13)22)18-23-16(2,3)17(4,5)24-18/h6-9,21-22H,10H2,1-5H3,(H,19,20) |
| InChIKey | PWWVYNRDTPAFRR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|