C16H23BN2O4 — CID 170807471
N-[3-(1-oxidopyridin-1-ium-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170807471) has the molecular formula C16H23BN2O4 and a molecular weight of 318.18 g/mol. Its IUPAC name is N-[3-(1-oxidopyridin-1-ium-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(1-oxidopyridin-1-ium-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807471 |
| Molecular Formula | C16H23BN2O4 |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | N-[3-(1-oxidopyridin-1-ium-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1ccc[n+]([O-])c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H23BN2O4/c1-12(20)18-10-14(9-13-7-6-8-19(21)11-13)17-22-15(2,3)16(4,5)23-17/h6-9,11H,10H2,1-5H3,(H,18,20) |
| InChIKey | KPLJIQSUFVWGLJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|