C15H22BNO4 — CID 170807341
N-[3-(furan-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170807341) has the molecular formula C15H22BNO4 and a molecular weight of 291.16 g/mol. Its IUPAC name is N-[3-(furan-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(furan-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807341 |
| Molecular Formula | C15H22BNO4 |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[3-(furan-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1ccoc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H22BNO4/c1-11(18)17-9-13(8-12-6-7-19-10-12)16-20-14(2,3)15(4,5)21-16/h6-8,10H,9H2,1-5H3,(H,17,18) |
| InChIKey | XIVSFOVZHDDPEG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|