C17H23BN2O5 — CID 170808045
4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylic acid (PubChem CID 170808045) has the molecular formula C17H23BN2O5 and a molecular weight of 346.19 g/mol. Its IUPAC name is 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylic acid.
| Compound Name | 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 170808045 |
| Molecular Formula | C17H23BN2O5 |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridine-2-carboxylic acid |
| SMILES | CC(=O)NCC(=Cc1ccnc(C(=O)O)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H23BN2O5/c1-11(21)20-10-13(18-24-16(2,3)17(4,5)25-18)8-12-6-7-19-14(9-12)15(22)23/h6-9H,10H2,1-5H3,(H,20,21)(H,22,23) |
| InChIKey | ASOWEGNYJUDHJQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|