C18H27BN2O3 — CID 170807694
N-[3-(2,6-dimethyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170807694) has the molecular formula C18H27BN2O3 and a molecular weight of 330.24 g/mol. Its IUPAC name is N-[3-(2,6-dimethyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(2,6-dimethyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807694 |
| Molecular Formula | C18H27BN2O3 |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | N-[3-(2,6-dimethyl-4-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1cc(C)nc(C)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H27BN2O3/c1-12-8-15(9-13(2)21-12)10-16(11-20-14(3)22)19-23-17(4,5)18(6,7)24-19/h8-10H,11H2,1-7H3,(H,20,22) |
| InChIKey | FCYGXLHHNQIWIB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|