C19H25BN2O4 — CID 170808183
N-[3-(2-methyl-1,3-benzoxazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808183) has the molecular formula C19H25BN2O4 and a molecular weight of 356.23 g/mol. Its IUPAC name is N-[3-(2-methyl-1,3-benzoxazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(2-methyl-1,3-benzoxazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808183 |
| Molecular Formula | C19H25BN2O4 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[3-(2-methyl-1,3-benzoxazol-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1ccc2nc(C)oc2c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H25BN2O4/c1-12(23)21-11-15(20-25-18(3,4)19(5,6)26-20)9-14-7-8-16-17(10-14)24-13(2)22-16/h7-10H,11H2,1-6H3,(H,21,23) |
| InChIKey | HIQFRLVQKJCXCM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|