C21H26BNO4 — CID 170808584
N-[3-(7-hydroxynaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808584) has the molecular formula C21H26BNO4 and a molecular weight of 367.25 g/mol. Its IUPAC name is N-[3-(7-hydroxynaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(7-hydroxynaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808584 |
| Molecular Formula | C21H26BNO4 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | N-[3-(7-hydroxynaphthalen-2-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1ccc2ccc(O)cc2c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H26BNO4/c1-14(24)23-13-18(22-26-20(2,3)21(4,5)27-22)11-15-6-7-16-8-9-19(25)12-17(16)10-15/h6-12,25H,13H2,1-5H3,(H,23,24) |
| InChIKey | OIIBGRJQEZDJSZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|