C19H26BNO6 — CID 170808505
methyl 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-hydroxybenzoate (PubChem CID 170808505) has the molecular formula C19H26BNO6 and a molecular weight of 375.23 g/mol. Its IUPAC name is methyl 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-hydroxybenzoate.
| Compound Name | methyl 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 170808505 |
| Molecular Formula | C19H26BNO6 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | methyl 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(C=C(CNC(C)=O)B2OC(C)(C)C(C)(C)O2)cc1O |
| InChI | InChI=1S/C19H26BNO6/c1-12(22)21-11-14(20-26-18(2,3)19(4,5)27-20)9-13-7-8-15(16(23)10-13)17(24)25-6/h7-10,23H,11H2,1-6H3,(H,21,22) |
| InChIKey | AWQURMRYQAAFDH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|