C19H24BF2NO5 — CID 170808701
methyl 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,6-difluorobenzoate (PubChem CID 170808701) has the molecular formula C19H24BF2NO5 and a molecular weight of 395.21 g/mol. Its IUPAC name is methyl 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,6-difluorobenzoate.
| Compound Name | methyl 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 170808701 |
| Molecular Formula | C19H24BF2NO5 |
| Molecular Weight | 395.21 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | methyl 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,6-difluorobenzoate |
| SMILES | COC(=O)c1c(F)cc(C=C(CNC(C)=O)B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C19H24BF2NO5/c1-11(24)23-10-13(20-27-18(2,3)19(4,5)28-20)7-12-8-14(21)16(15(22)9-12)17(25)26-6/h7-9H,10H2,1-6H3,(H,23,24) |
| InChIKey | AMUHBGJXYBNIDN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|