C18H24BF2NO4 — CID 170808299
N-[3-[3,5-difluoro-4-(hydroxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808299) has the molecular formula C18H24BF2NO4 and a molecular weight of 367.20 g/mol. Its IUPAC name is N-[3-[3,5-difluoro-4-(hydroxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-[3,5-difluoro-4-(hydroxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808299 |
| Molecular Formula | C18H24BF2NO4 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-[3-[3,5-difluoro-4-(hydroxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1cc(F)c(CO)c(F)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H24BF2NO4/c1-11(24)22-9-13(19-25-17(2,3)18(4,5)26-19)6-12-7-15(20)14(10-23)16(21)8-12/h6-8,23H,9-10H2,1-5H3,(H,22,24) |
| InChIKey | XORUXKXRFBUFQJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|