C16H21BF2N2O3 — CID 170807705
N-[3-(5,6-difluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170807705) has the molecular formula C16H21BF2N2O3 and a molecular weight of 338.16 g/mol. Its IUPAC name is N-[3-(5,6-difluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(5,6-difluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807705 |
| Molecular Formula | C16H21BF2N2O3 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[3-(5,6-difluoro-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1cnc(F)c(F)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H21BF2N2O3/c1-10(22)20-9-12(6-11-7-13(18)14(19)21-8-11)17-23-15(2,3)16(4,5)24-17/h6-8H,9H2,1-5H3,(H,20,22) |
| InChIKey | LZAZXVKMEQOQHA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|