C18H24BNO5 — CID 170807814
4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid (PubChem CID 170807814) has the molecular formula C18H24BNO5 and a molecular weight of 345.20 g/mol. Its IUPAC name is 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 170807814 |
| Molecular Formula | C18H24BNO5 |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoic acid |
| SMILES | CC(=O)NCC(=Cc1ccc(C(=O)O)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H24BNO5/c1-12(21)20-11-15(19-24-17(2,3)18(4,5)25-19)10-13-6-8-14(9-7-13)16(22)23/h6-10H,11H2,1-5H3,(H,20,21)(H,22,23) |
| InChIKey | INTXMHMJCOOXQI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|