C20H25BN2O4 — CID 170808633
N-[3-[4-(1,2-oxazol-5-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808633) has the molecular formula C20H25BN2O4 and a molecular weight of 368.24 g/mol. Its IUPAC name is N-[3-[4-(1,2-oxazol-5-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-[4-(1,2-oxazol-5-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808633 |
| Molecular Formula | C20H25BN2O4 |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-[3-[4-(1,2-oxazol-5-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1ccc(-c2ccno2)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H25BN2O4/c1-14(24)22-13-17(21-26-19(2,3)20(4,5)27-21)12-15-6-8-16(9-7-15)18-10-11-23-25-18/h6-12H,13H2,1-5H3,(H,22,24) |
| InChIKey | OQLUHLGGTQKUNJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|