C19H25BN2O3 — CID 170815149
N-methyl-3-[4-(1,2-oxazol-5-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170815149) has the molecular formula C19H25BN2O3 and a molecular weight of 340.23 g/mol. Its IUPAC name is N-methyl-3-[4-(1,2-oxazol-5-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | N-methyl-3-[4-(1,2-oxazol-5-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170815149 |
| Molecular Formula | C19H25BN2O3 |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | N-methyl-3-[4-(1,2-oxazol-5-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CNCC(=Cc1ccc(-c2ccno2)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H25BN2O3/c1-18(2)19(3,4)25-20(24-18)16(13-21-5)12-14-6-8-15(9-7-14)17-10-11-22-23-17/h6-12,21H,13H2,1-5H3 |
| InChIKey | QEIKXVBPCKJTHF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|