C19H28BNO4 — CID 170815466
ethyl 4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate (PubChem CID 170815466) has the molecular formula C19H28BNO4 and a molecular weight of 345.25 g/mol. Its IUPAC name is ethyl 4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate.
| Compound Name | ethyl 4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 170815466 |
| Molecular Formula | C19H28BNO4 |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | ethyl 4-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C=C(CNC)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C19H28BNO4/c1-7-23-17(22)15-10-8-14(9-11-15)12-16(13-21-6)20-24-18(2,3)19(4,5)25-20/h8-12,21H,7,13H2,1-6H3 |
| InChIKey | ZGWAKZZABBJXFX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|