C19H27BO4S — CID 170803811
ethyl 2-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetate (PubChem CID 170803811) has the molecular formula C19H27BO4S and a molecular weight of 362.30 g/mol. Its IUPAC name is ethyl 2-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetate |
|---|---|
| PubChem CID | 170803811 |
| Molecular Formula | C19H27BO4S |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | ethyl 2-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C=C(CS)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C19H27BO4S/c1-6-22-17(21)12-15-9-7-14(8-10-15)11-16(13-25)20-23-18(2,3)19(4,5)24-20/h7-11,25H,6,12-13H2,1-5H3 |
| InChIKey | PNSRDUCDDVANAG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|