C17H22BClO3S — CID 170803376
2-chloro-1-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanone (PubChem CID 170803376) has the molecular formula C17H22BClO3S and a molecular weight of 352.69 g/mol. Its IUPAC name is 2-chloro-1-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanone.
| Compound Name | 2-chloro-1-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanone |
|---|---|
| PubChem CID | 170803376 |
| Molecular Formula | C17H22BClO3S |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-chloro-1-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanone |
| SMILES | CC1(C)OB(C(=Cc2ccc(C(=O)CCl)cc2)CS)OC1(C)C |
| InChI | InChI=1S/C17H22BClO3S/c1-16(2)17(3,4)22-18(21-16)14(11-23)9-12-5-7-13(8-6-12)15(20)10-19/h5-9,23H,10-11H2,1-4H3 |
| InChIKey | HDVKQTOZKJDBJW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|