C17H24BNO3S — CID 170803510
N-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetamide (PubChem CID 170803510) has the molecular formula C17H24BNO3S and a molecular weight of 333.26 g/mol. Its IUPAC name is N-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetamide.
| Compound Name | N-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 170803510 |
| Molecular Formula | C17H24BNO3S |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-[4-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C=C(CS)B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C17H24BNO3S/c1-12(20)19-15-8-6-13(7-9-15)10-14(11-23)18-21-16(2,3)17(4,5)22-18/h6-10,23H,11H2,1-5H3,(H,19,20) |
| InChIKey | KBIOUGVNYAKBSL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|