C17H23BClNO4 — CID 170802041
2-chloro-N-[4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetamide (PubChem CID 170802041) has the molecular formula C17H23BClNO4 and a molecular weight of 351.64 g/mol. Its IUPAC name is 2-chloro-N-[4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 170802041 |
| Molecular Formula | C17H23BClNO4 |
| Molecular Weight | 351.64 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-chloro-N-[4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetamide |
| SMILES | CC1(C)OB(C(=Cc2ccc(NC(=O)CCl)cc2)CO)OC1(C)C |
| InChI | InChI=1S/C17H23BClNO4/c1-16(2)17(3,4)24-18(23-16)13(11-21)9-12-5-7-14(8-6-12)20-15(22)10-19/h5-9,21H,10-11H2,1-4H3,(H,20,22) |
| InChIKey | DUVWZFFHBXIZDY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.64 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|