C16H21BF2O3 — CID 170801280
3-[4-(difluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 170801280) has the molecular formula C16H21BF2O3 and a molecular weight of 310.15 g/mol. Its IUPAC name is 3-[4-(difluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | 3-[4-(difluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 170801280 |
| Molecular Formula | C16H21BF2O3 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 3-[4-(difluoromethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | CC1(C)OB(C(=Cc2ccc(C(F)F)cc2)CO)OC1(C)C |
| InChI | InChI=1S/C16H21BF2O3/c1-15(2)16(3,4)22-17(21-15)13(10-20)9-11-5-7-12(8-6-11)14(18)19/h5-9,14,20H,10H2,1-4H3 |
| InChIKey | XVMBRXLELJIZAO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|