C16H22BBrO3 — CID 170802351
3-(4-bromo-3-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 170802351) has the molecular formula C16H22BBrO3 and a molecular weight of 353.07 g/mol. Its IUPAC name is 3-(4-bromo-3-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | 3-(4-bromo-3-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 170802351 |
| Molecular Formula | C16H22BBrO3 |
| Molecular Weight | 353.07 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3-(4-bromo-3-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | Cc1cc(C=C(CO)B2OC(C)(C)C(C)(C)O2)ccc1Br |
| InChI | InChI=1S/C16H22BBrO3/c1-11-8-12(6-7-14(11)18)9-13(10-19)17-20-15(2,3)16(4,5)21-17/h6-9,19H,10H2,1-5H3 |
| InChIKey | ZHDYXADUXLNURT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.07 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|