C17H26BNO3 — CID 170801483
3-(4-amino-3,5-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 170801483) has the molecular formula C17H26BNO3 and a molecular weight of 303.21 g/mol. Its IUPAC name is 3-(4-amino-3,5-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | 3-(4-amino-3,5-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 170801483 |
| Molecular Formula | C17H26BNO3 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 3-(4-amino-3,5-dimethylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | Cc1cc(C=C(CO)B2OC(C)(C)C(C)(C)O2)cc(C)c1N |
| InChI | InChI=1S/C17H26BNO3/c1-11-7-13(8-12(2)15(11)19)9-14(10-20)18-21-16(3,4)17(5,6)22-18/h7-9,20H,10,19H2,1-6H3 |
| InChIKey | LJARFGHBXYUDPL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|