C20H31B2NO5 — CID 170802327
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]prop-2-en-1-ol (PubChem CID 170802327) has the molecular formula C20H31B2NO5 and a molecular weight of 387.09 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]prop-2-en-1-ol.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 170802327 |
| Molecular Formula | C20H31B2NO5 |
| Molecular Weight | 387.09 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]prop-2-en-1-ol |
| SMILES | CC1(C)OB(C(=Cc2cncc(B3OC(C)(C)C(C)(C)O3)c2)CO)OC1(C)C |
| InChI | InChI=1S/C20H31B2NO5/c1-17(2)18(3,4)26-21(25-17)15-9-14(11-23-12-15)10-16(13-24)22-27-19(5,6)20(7,8)28-22/h9-12,24H,13H2,1-8H3 |
| InChIKey | ZDRJBUNRWQYARD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.09 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|