C15H20BNO3 — CID 170482853
4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]but-3-enal (PubChem CID 170482853) has the molecular formula C15H20BNO3 and a molecular weight of 273.14 g/mol. Its IUPAC name is 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]but-3-enal.
| Compound Name | 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]but-3-enal |
|---|---|
| PubChem CID | 170482853 |
| Molecular Formula | C15H20BNO3 |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]but-3-enal |
| SMILES | CC1(C)OB(c2cncc(C=CCC=O)c2)OC1(C)C |
| InChI | InChI=1S/C15H20BNO3/c1-14(2)15(3,4)20-16(19-14)13-9-12(10-17-11-13)7-5-6-8-18/h5,7-11H,6H2,1-4H3 |
| InChIKey | FYGRQZGFLJSNLH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|