C14H20BNO4 — CID 170800946
5-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-3-ol (PubChem CID 170800946) has the molecular formula C14H20BNO4 and a molecular weight of 277.13 g/mol. Its IUPAC name is 5-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-3-ol.
| Compound Name | 5-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-3-ol |
|---|---|
| PubChem CID | 170800946 |
| Molecular Formula | C14H20BNO4 |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 5-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]pyridin-3-ol |
| SMILES | CC1(C)OB(C(=Cc2cncc(O)c2)CO)OC1(C)C |
| InChI | InChI=1S/C14H20BNO4/c1-13(2)14(3,4)20-15(19-13)11(9-17)5-10-6-12(18)8-16-7-10/h5-8,17-18H,9H2,1-4H3 |
| InChIKey | KIZMPHQFSMBBAS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|