C18H28BN3O3 — CID 170807932
N-[3-(3,4-diamino-5-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170807932) has the molecular formula C18H28BN3O3 and a molecular weight of 345.25 g/mol. Its IUPAC name is N-[3-(3,4-diamino-5-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(3,4-diamino-5-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807932 |
| Molecular Formula | C18H28BN3O3 |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | N-[3-(3,4-diamino-5-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1cc(C)c(N)c(N)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H28BN3O3/c1-11-7-13(9-15(20)16(11)21)8-14(10-22-12(2)23)19-24-17(3,4)18(5,6)25-19/h7-9H,10,20-21H2,1-6H3,(H,22,23) |
| InChIKey | LVEOKNVFWJUHAT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|