C16H21BF3NO4 — CID 170802241
3-[4-amino-3-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 170802241) has the molecular formula C16H21BF3NO4 and a molecular weight of 359.15 g/mol. Its IUPAC name is 3-[4-amino-3-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | 3-[4-amino-3-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 170802241 |
| Molecular Formula | C16H21BF3NO4 |
| Molecular Weight | 359.15 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-[4-amino-3-(trifluoromethoxy)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | CC1(C)OB(C(=Cc2ccc(N)c(OC(F)(F)F)c2)CO)OC1(C)C |
| InChI | InChI=1S/C16H21BF3NO4/c1-14(2)15(3,4)25-17(24-14)11(9-22)7-10-5-6-12(21)13(8-10)23-16(18,19)20/h5-8,22H,9,21H2,1-4H3 |
| InChIKey | HXKVPKNEUFIYLK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.15 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|