C16H23BN2O4 — CID 170801808
4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide (PubChem CID 170801808) has the molecular formula C16H23BN2O4 and a molecular weight of 318.18 g/mol. Its IUPAC name is 4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide.
| Compound Name | 4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide |
|---|---|
| PubChem CID | 170801808 |
| Molecular Formula | C16H23BN2O4 |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide |
| SMILES | CC1(C)OB(C(=Cc2ccc(C(=O)NN)cc2)CO)OC1(C)C |
| InChI | InChI=1S/C16H23BN2O4/c1-15(2)16(3,4)23-17(22-15)13(10-20)9-11-5-7-12(8-6-11)14(21)19-18/h5-9,20H,10,18H2,1-4H3,(H,19,21) |
| InChIKey | JCKIADDZEGYHML-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|