C16H24BN3O3 — CID 170806696
3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide (PubChem CID 170806696) has the molecular formula C16H24BN3O3 and a molecular weight of 317.20 g/mol. Its IUPAC name is 3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide.
| Compound Name | 3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide |
|---|---|
| PubChem CID | 170806696 |
| Molecular Formula | C16H24BN3O3 |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzohydrazide |
| SMILES | CC1(C)OB(C(=Cc2cccc(C(=O)NN)c2)CN)OC1(C)C |
| InChI | InChI=1S/C16H24BN3O3/c1-15(2)16(3,4)23-17(22-15)13(10-18)9-11-6-5-7-12(8-11)14(21)20-19/h5-9H,10,18-19H2,1-4H3,(H,20,21) |
| InChIKey | KSQVLYYOACIUHI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|