C18H23BF3NO3 — CID 170815221
2,2,2-trifluoro-1-[3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanone (PubChem CID 170815221) has the molecular formula C18H23BF3NO3 and a molecular weight of 369.19 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanone |
|---|---|
| PubChem CID | 170815221 |
| Molecular Formula | C18H23BF3NO3 |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2,2,2-trifluoro-1-[3-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanone |
| SMILES | CNCC(=Cc1cccc(C(=O)C(F)(F)F)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H23BF3NO3/c1-16(2)17(3,4)26-19(25-16)14(11-23-5)10-12-7-6-8-13(9-12)15(24)18(20,21)22/h6-10,23H,11H2,1-5H3 |
| InChIKey | JUNRBLUQCMOENN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|