C20H31BN2O3 — CID 170815194
N-methyl-3-(3-morpholin-4-ylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170815194) has the molecular formula C20H31BN2O3 and a molecular weight of 358.29 g/mol. Its IUPAC name is N-methyl-3-(3-morpholin-4-ylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | N-methyl-3-(3-morpholin-4-ylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170815194 |
| Molecular Formula | C20H31BN2O3 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-methyl-3-(3-morpholin-4-ylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CNCC(=Cc1cccc(N2CCOCC2)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H31BN2O3/c1-19(2)20(3,4)26-21(25-19)17(15-22-5)13-16-7-6-8-18(14-16)23-9-11-24-12-10-23/h6-8,13-14,22H,9-12,15H2,1-5H3 |
| InChIKey | FOLFTOKSVFBLDB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|