C16H23BN4O2 — CID 170814601
3-(3-azidophenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170814601) has the molecular formula C16H23BN4O2 and a molecular weight of 314.20 g/mol. Its IUPAC name is 3-(3-azidophenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(3-azidophenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170814601 |
| Molecular Formula | C16H23BN4O2 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 3-(3-azidophenyl)-N-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CNCC(=Cc1cccc(N=[N+]=[N-])c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H23BN4O2/c1-15(2)16(3,4)23-17(22-15)13(11-19-5)9-12-7-6-8-14(10-12)20-21-18/h6-10,19H,11H2,1-5H3 |
| InChIKey | RELSHOUKIQXJID-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|