C30H31BN4O4 — CID 170811343
9H-fluoren-9-ylmethyl N-[3-(3-azidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170811343) has the molecular formula C30H31BN4O4 and a molecular weight of 522.41 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(3-azidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(3-azidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170811343 |
| Molecular Formula | C30H31BN4O4 |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(3-azidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cccc(N=[N+]=[N-])c2)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C30H31BN4O4/c1-29(2)30(3,4)39-31(38-29)21(16-20-10-9-11-22(17-20)34-35-32)18-33-28(36)37-19-27-25-14-7-5-12-23(25)24-13-6-8-15-26(24)27/h5-17,27H,18-19H2,1-4H3,(H,33,36) |
| InChIKey | RZRKUQVWENRAHP-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|