C15H20BN3O2S — CID 170803198
3-(3-azidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170803198) has the molecular formula C15H20BN3O2S and a molecular weight of 317.22 g/mol. Its IUPAC name is 3-(3-azidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(3-azidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170803198 |
| Molecular Formula | C15H20BN3O2S |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-(3-azidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2cccc(N=[N+]=[N-])c2)CS)OC1(C)C |
| InChI | InChI=1S/C15H20BN3O2S/c1-14(2)15(3,4)21-16(20-14)12(10-22)8-11-6-5-7-13(9-11)18-19-17/h5-9,22H,10H2,1-4H3 |
| InChIKey | FJYNJSIWEUBPSW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|