C21H24BNO2S — CID 170803916
3-(9H-carbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170803916) has the molecular formula C21H24BNO2S and a molecular weight of 365.31 g/mol. Its IUPAC name is 3-(9H-carbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(9H-carbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170803916 |
| Molecular Formula | C21H24BNO2S |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-(9H-carbazol-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | CC1(C)OB(C(=Cc2ccc3[nH]c4ccccc4c3c2)CS)OC1(C)C |
| InChI | InChI=1S/C21H24BNO2S/c1-20(2)21(3,4)25-22(24-20)15(13-26)11-14-9-10-19-17(12-14)16-7-5-6-8-18(16)23-19/h5-12,23,26H,13H2,1-4H3 |
| InChIKey | ACTUJERCHPWAQX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|