C19H24BN3O5 — CID 170808660
N-[3-(2,4-dioxo-1H-quinazolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808660) has the molecular formula C19H24BN3O5 and a molecular weight of 385.23 g/mol. Its IUPAC name is N-[3-(2,4-dioxo-1H-quinazolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(2,4-dioxo-1H-quinazolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808660 |
| Molecular Formula | C19H24BN3O5 |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-[3-(2,4-dioxo-1H-quinazolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1ccc2[nH]c(=O)[nH]c(=O)c2c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H24BN3O5/c1-11(24)21-10-13(20-27-18(2,3)19(4,5)28-20)8-12-6-7-15-14(9-12)16(25)23-17(26)22-15/h6-9H,10H2,1-5H3,(H,21,24)(H2,22,23,25,26) |
| InChIKey | HNFTVVOVJLWISM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|