C25H26BNO5 — CID 170808849
N-[3-(9,10-dioxophenanthren-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808849) has the molecular formula C25H26BNO5 and a molecular weight of 431.30 g/mol. Its IUPAC name is N-[3-(9,10-dioxophenanthren-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(9,10-dioxophenanthren-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808849 |
| Molecular Formula | C25H26BNO5 |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[3-(9,10-dioxophenanthren-3-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1ccc2c(c1)-c1ccccc1C(=O)C2=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H26BNO5/c1-15(28)27-14-17(26-31-24(2,3)25(4,5)32-26)12-16-10-11-20-21(13-16)18-8-6-7-9-19(18)22(29)23(20)30/h6-13H,14H2,1-5H3,(H,27,28) |
| InChIKey | XKPPIQUMZUJQBQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|