C19H25BN2O4 — CID 170808180
N-[3-(3-oxo-1,2-dihydroisoindol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808180) has the molecular formula C19H25BN2O4 and a molecular weight of 356.23 g/mol. Its IUPAC name is N-[3-(3-oxo-1,2-dihydroisoindol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(3-oxo-1,2-dihydroisoindol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808180 |
| Molecular Formula | C19H25BN2O4 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[3-(3-oxo-1,2-dihydroisoindol-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1ccc2c(c1)C(=O)NC2)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H25BN2O4/c1-12(23)21-11-15(20-25-18(2,3)19(4,5)26-20)8-13-6-7-14-10-22-17(24)16(14)9-13/h6-9H,10-11H2,1-5H3,(H,21,23)(H,22,24) |
| InChIKey | YIYYLHPHOVZFJB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|