C17H23BN2O3 — CID 170806552
5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,3-dihydroisoindol-1-one (PubChem CID 170806552) has the molecular formula C17H23BN2O3 and a molecular weight of 314.19 g/mol. Its IUPAC name is 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 170806552 |
| Molecular Formula | C17H23BN2O3 |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,3-dihydroisoindol-1-one |
| SMILES | CC1(C)OB(C(=Cc2ccc3c(c2)CNC3=O)CN)OC1(C)C |
| InChI | InChI=1S/C17H23BN2O3/c1-16(2)17(3,4)23-18(22-16)13(9-19)8-11-5-6-14-12(7-11)10-20-15(14)21/h5-8H,9-10,19H2,1-4H3,(H,20,21) |
| InChIKey | OFUIMQZHZPYKKK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|