C19H26BNO3 — CID 170806950
7-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 170806950) has the molecular formula C19H26BNO3 and a molecular weight of 327.23 g/mol. Its IUPAC name is 7-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 7-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 170806950 |
| Molecular Formula | C19H26BNO3 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 7-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC1(C)OB(C(=Cc2ccc3c(c2)C(=O)CCC3)CN)OC1(C)C |
| InChI | InChI=1S/C19H26BNO3/c1-18(2)19(3,4)24-20(23-18)15(12-21)10-13-8-9-14-6-5-7-17(22)16(14)11-13/h8-11H,5-7,12,21H2,1-4H3 |
| InChIKey | ICDIWLPVEVXMJI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|